C25H25F4N5O — CID 144758396
N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(2-phenylethynyl)-2-pyridinyl]propyl]methanimidamide;ethane (PubChem CID 144758396) has the molecular formula C25H25F4N5O and a molecular weight of 487.50 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(2-phenylethynyl)-2-pyridinyl]propyl]methanimidamide;ethane.
| Compound Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(2-phenylethynyl)-2-pyridinyl]propyl]methanimidamide;ethane |
|---|---|
| PubChem CID | 144758396 |
| Molecular Formula | C25H25F4N5O |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(2-phenylethynyl)-2-pyridinyl]propyl]methanimidamide;ethane |
| SMILES | CC.N/N=C\N(N)CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(C#Cc2ccccc2)cn1 |
| InChI | InChI=1S/C23H19F4N5O.C2H6/c24-18-9-10-19(20(25)12-18)22(33,14-32(29)15-31-28)23(26,27)21-11-8-17(13-30-21)7-6-16-4-2-1-3-5-16;1-2/h1-5,8-13,15,33H,14,28-29H2;1-2H3/b31-15-; |
| InChIKey | VHMZCTQCDZWIDA-YXJRXBLDSA-N |
| XLogP | 3.84 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|