C21H20F4N6O2 — CID 135293369
N'-[amino-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(pyridin-2-ylmethoxy)-2-pyridinyl]propyl]amino]methanimidamide (PubChem CID 135293369) has the molecular formula C21H20F4N6O2 and a molecular weight of 464.42 g/mol. Its IUPAC name is N'-[amino-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(pyridin-2-ylmethoxy)-2-pyridinyl]propyl]amino]methanimidamide.
| Compound Name | N'-[amino-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(pyridin-2-ylmethoxy)-2-pyridinyl]propyl]amino]methanimidamide |
|---|---|
| PubChem CID | 135293369 |
| Molecular Formula | C21H20F4N6O2 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N'-[amino-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(pyridin-2-ylmethoxy)-2-pyridinyl]propyl]amino]methanimidamide |
| SMILES | N/C=N\N(N)CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(OCc2ccccn2)cn1 |
| InChI | InChI=1S/C21H20F4N6O2/c22-14-4-6-17(18(23)9-14)20(32,12-31(27)30-13-26)21(24,25)19-7-5-16(10-29-19)33-11-15-3-1-2-8-28-15/h1-10,13,32H,11-12,27H2,(H2,26,30) |
| InChIKey | FOAKVWQEQSRADV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|