C19H15F4N5O2 — CID 71138716
1-(5-but-2-ynoxy-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-2-yl)propan-2-ol (PubChem CID 71138716) has the molecular formula C19H15F4N5O2 and a molecular weight of 421.35 g/mol. Its IUPAC name is 1-(5-but-2-ynoxy-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-2-yl)propan-2-ol.
| Compound Name | 1-(5-but-2-ynoxy-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 71138716 |
| Molecular Formula | C19H15F4N5O2 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-(5-but-2-ynoxy-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-2-yl)propan-2-ol |
| SMILES | CC#CCOc1ccc(C(F)(F)C(O)(Cn2ncnn2)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C19H15F4N5O2/c1-2-3-8-30-14-5-7-17(24-10-14)19(22,23)18(29,11-28-26-12-25-27-28)15-6-4-13(20)9-16(15)21/h4-7,9-10,12,29H,8,11H2,1H3 |
| InChIKey | YLSNKMKINNBMNS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|