C14H11F4IN2O — CID 118397062
3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-iodo-2-pyridinyl)propan-2-ol (PubChem CID 118397062) has the molecular formula C14H11F4IN2O and a molecular weight of 426.15 g/mol. Its IUPAC name is 3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-iodo-2-pyridinyl)propan-2-ol.
| Compound Name | 3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-iodo-2-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 118397062 |
| Molecular Formula | C14H11F4IN2O |
| Molecular Weight | 426.15 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-iodo-2-pyridinyl)propan-2-ol |
| SMILES | NCC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(I)cn1 |
| InChI | InChI=1S/C14H11F4IN2O/c15-8-1-3-10(11(16)5-8)13(22,7-20)14(17,18)12-4-2-9(19)6-21-12/h1-6,22H,7,20H2 |
| InChIKey | AEPOURGVZGGRCM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|