About (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol
(2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol (PubChem CID 118397061) has the molecular formula C15H14F4N2O
and a molecular weight of 314.28 g/mol. Its IUPAC name is (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol.
Molecular Properties
| Compound Name | (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol |
| PubChem CID | 118397061 |
| Molecular Formula | C15H14F4N2O |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol |
| SMILES | Cc1ccc(C(F)(F)[C@](O)(CN)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C15H14F4N2O/c1-9-2-5-13(21-7-9)15(18,19)14(22,8-20)11-4-3-10(16)6-12(11)17/h2-7,22H,8,20H2,1H3/t14-/m0/s1 |
| InChIKey | IHDUCNZRXDYVPQ-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol?
The IUPAC name of (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol (CID 118397061) is (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol.
What is the SMILES notation for (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol?
The canonical SMILES for (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol is Cc1ccc(C(F)(F)[C@](O)(CN)c2ccc(F)cc2F)nc1.
What is the InChIKey of (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol?
The InChIKey is IHDUCNZRXDYVPQ-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H14F4N2O/c1-9-2-5-13(21-7-9)15(18,19)14(22,8-20)11-4-3-10(16)6-12(11)17/h2-7,22H,8,20H2,1H3/t14-/m0/s1.
What are the key properties of (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol?
(2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol has a molecular weight of 314.28 g/mol, XLogP of 2.61, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-amino-2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-methyl-2-pyridinyl)propan-2-ol is sourced from PubChem (CID 118397061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).