C15H14BrF4N5O — CID 137426978
N,N'-diamino-N-[3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide (PubChem CID 137426978) has the molecular formula C15H14BrF4N5O and a molecular weight of 436.21 g/mol. Its IUPAC name is N,N'-diamino-N-[3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide |
|---|---|
| PubChem CID | 137426978 |
| Molecular Formula | C15H14BrF4N5O |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | N,N'-diamino-N-[3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide |
| SMILES | N/N=C\N(N)CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(Br)cn1 |
| InChI | InChI=1S/C15H14BrF4N5O/c16-9-1-4-13(23-6-9)15(19,20)14(26,7-25(22)8-24-21)11-3-2-10(17)5-12(11)18/h1-6,8,26H,7,21-22H2/b24-8- |
| InChIKey | IIXOWRXCFMKPGX-GYRAYZOKSA-N |
| XLogP | 2.18 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|