C15H13BrF4N5O+ — CID 147944349
[3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]-[(iminohydrazinylidene)methyl]azanium (PubChem CID 147944349) has the molecular formula C15H13BrF4N5O+ and a molecular weight of 435.20 g/mol. Its IUPAC name is [3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]-[(iminohydrazinylidene)methyl]azanium.
| Compound Name | [3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]-[(iminohydrazinylidene)methyl]azanium |
|---|---|
| PubChem CID | 147944349 |
| Molecular Formula | C15H13BrF4N5O+ |
| Molecular Weight | 435.20 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | [3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]-[(iminohydrazinylidene)methyl]azanium |
| SMILES | [H]/N=N/N=C[NH2+]CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(Br)cn1 |
| InChI | InChI=1S/C15H12BrF4N5O/c16-9-1-4-13(23-6-9)15(19,20)14(26,7-22-8-24-25-21)11-3-2-10(17)5-12(11)18/h1-6,8,26H,7H2,(H2,21,22,24)/p+1 |
| InChIKey | IMJFWCPTAQNCQJ-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|