C24H22F7N5O — CID 178082584
N'-[[2-amino-2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propyl]amino]ethanimidamide (PubChem CID 178082584) has the molecular formula C24H22F7N5O and a molecular weight of 529.46 g/mol. Its IUPAC name is N'-[[2-amino-2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propyl]amino]ethanimidamide.
| Compound Name | N'-[[2-amino-2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propyl]amino]ethanimidamide |
|---|---|
| PubChem CID | 178082584 |
| Molecular Formula | C24H22F7N5O |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | N'-[[2-amino-2-(2,4-difluorophenyl)-3,3-difluoro-3-[5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-pyridinyl]propyl]amino]ethanimidamide |
| SMILES | C/C(N)=N/NCC(N)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OCC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C24H22F7N5O/c1-14(32)36-35-12-22(33,19-8-5-17(25)10-20(19)26)24(30,31)21-9-4-16(11-34-21)15-2-6-18(7-3-15)37-13-23(27,28)29/h2-11,35H,12-13,33H2,1H3,(H2,32,36) |
| InChIKey | GVZJRCQRWFSFOU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|