About N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate
N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate (PubChem CID 145317350) has the molecular formula C16H26N2S
and a molecular weight of 278.47 g/mol. Its IUPAC name is N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate.
Molecular Properties
| Compound Name | N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate |
| PubChem CID | 145317350 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate |
| SMILES | CCCCN(C)CC.CCc1ccc(SC#N)cc1 |
| InChI | InChI=1S/C9H9NS.C7H17N/c1-2-8-3-5-9(6-4-8)11-7-10;1-4-6-7-8(3)5-2/h3-6H,2H2,1H3;4-7H2,1-3H3 |
| InChIKey | FYFADYYTKOOMBX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate?
The IUPAC name of N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate (CID 145317350) is N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate.
What is the SMILES notation for N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate?
The canonical SMILES for N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate is CCCCN(C)CC.CCc1ccc(SC#N)cc1.
What is the InChIKey of N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate?
The InChIKey is FYFADYYTKOOMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS.C7H17N/c1-2-8-3-5-9(6-4-8)11-7-10;1-4-6-7-8(3)5-2/h3-6H,2H2,1H3;4-7H2,1-3H3.
What are the key properties of N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate?
N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate has a molecular weight of 278.47 g/mol, XLogP of 4.56, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylbutan-1-amine;(4-ethylphenyl) thiocyanate is sourced from PubChem (CID 145317350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).