C13H22FN3 — CID 145318039
2-[amino(tert-butyl)amino]-4-(fluoromethyl)-5-methylcyclohepta-1,3,5-trien-1-amine (PubChem CID 145318039) has the molecular formula C13H22FN3 and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-[amino(tert-butyl)amino]-4-(fluoromethyl)-5-methylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | 2-[amino(tert-butyl)amino]-4-(fluoromethyl)-5-methylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 145318039 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | 2-[amino(tert-butyl)amino]-4-(fluoromethyl)-5-methylcyclohepta-1,3,5-trien-1-amine |
| SMILES | CC1=CCC(N)=C(N(N)C(C)(C)C)C=C1CF |
| InChI | InChI=1S/C13H22FN3/c1-9-5-6-11(15)12(7-10(9)8-14)17(16)13(2,3)4/h5,7H,6,8,15-16H2,1-4H3 |
| InChIKey | FHVOOIIMONDENA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|