C9H14FN3 — CID 145318050
2-[amino(methyl)amino]-5-fluoro-6-methylcyclohepta-1,4,6-trien-1-amine (PubChem CID 145318050) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-5-fluoro-6-methylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | 2-[amino(methyl)amino]-5-fluoro-6-methylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 145318050 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 2-[amino(methyl)amino]-5-fluoro-6-methylcyclohepta-1,4,6-trien-1-amine |
| SMILES | CC1=CC(N)=C(N(C)N)CC=C1F |
| InChI | InChI=1S/C9H14FN3/c1-6-5-8(11)9(13(2)12)4-3-7(6)10/h3,5H,4,11-12H2,1-2H3 |
| InChIKey | QKPGCKLCJQVUNE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|