C9H17N3 — CID 143987367
(3Z)-4-[amino(methyl)amino]-2,5-dimethylhexa-1,3,5-trien-3-amine (PubChem CID 143987367) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (3Z)-4-[amino(methyl)amino]-2,5-dimethylhexa-1,3,5-trien-3-amine.
| Compound Name | (3Z)-4-[amino(methyl)amino]-2,5-dimethylhexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143987367 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (3Z)-4-[amino(methyl)amino]-2,5-dimethylhexa-1,3,5-trien-3-amine |
| SMILES | C=C(C)/C(N)=C(\C(=C)C)N(C)N |
| InChI | InChI=1S/C9H17N3/c1-6(2)8(10)9(7(3)4)12(5)11/h1,3,10-11H2,2,4-5H3/b9-8- |
| InChIKey | NUCYXVQSQFSSPC-HJWRWDBZSA-N |
| XLogP | 1.11 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|