C16H23ClF3N — CID 145319280
1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-4-methylpiperidine;ethane (PubChem CID 145319280) has the molecular formula C16H23ClF3N and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-4-methylpiperidine;ethane.
| Compound Name | 1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-4-methylpiperidine;ethane |
|---|---|
| PubChem CID | 145319280 |
| Molecular Formula | C16H23ClF3N |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-4-methylpiperidine;ethane |
| SMILES | CC.CC1CCN(Cc2cc(Cl)ccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H17ClF3N.C2H6/c1-10-4-6-19(7-5-10)9-11-8-12(15)2-3-13(11)14(16,17)18;1-2/h2-3,8,10H,4-7,9H2,1H3;1-2H3 |
| InChIKey | AOHOQXVSAFQHAO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |