C17H19Cl2F3N2O — CID 135321092
2-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carbonyl chloride (PubChem CID 135321092) has the molecular formula C17H19Cl2F3N2O and a molecular weight of 395.25 g/mol. Its IUPAC name is 2-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carbonyl chloride.
| Compound Name | 2-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carbonyl chloride |
|---|---|
| PubChem CID | 135321092 |
| Molecular Formula | C17H19Cl2F3N2O |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carbonyl chloride |
| SMILES | O=C(Cl)N1CCC2(CCN(Cc3cc(Cl)ccc3C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C17H19Cl2F3N2O/c18-13-1-2-14(17(20,21)22)12(9-13)10-23-6-3-16(11-23)4-7-24(8-5-16)15(19)25/h1-2,9H,3-8,10-11H2 |
| InChIKey | WATDOQZMPOYJHW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|