C25H33IN2O5S2 — CID 145321513
ethyl 2-[7-iodosulfanyl-5,8-dimethyl-2-(2-nitrophenyl)sulfanyl-3,4-dihydro-1H-isoquinolin-6-yl]acetate;2-methylpropan-2-ol (PubChem CID 145321513) has the molecular formula C25H33IN2O5S2 and a molecular weight of 632.59 g/mol. Its IUPAC name is ethyl 2-[7-iodosulfanyl-5,8-dimethyl-2-(2-nitrophenyl)sulfanyl-3,4-dihydro-1H-isoquinolin-6-yl]acetate;2-methylpropan-2-ol.
| Compound Name | ethyl 2-[7-iodosulfanyl-5,8-dimethyl-2-(2-nitrophenyl)sulfanyl-3,4-dihydro-1H-isoquinolin-6-yl]acetate;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 145321513 |
| Molecular Formula | C25H33IN2O5S2 |
| Molecular Weight | 632.59 g/mol |
| Exact Mass | 632.09 |
| IUPAC Name | ethyl 2-[7-iodosulfanyl-5,8-dimethyl-2-(2-nitrophenyl)sulfanyl-3,4-dihydro-1H-isoquinolin-6-yl]acetate;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CCOC(=O)Cc1c(C)c2c(c(C)c1SI)CN(Sc1ccccc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C21H23IN2O4S2.C4H10O/c1-4-28-20(25)11-16-13(2)15-9-10-23(12-17(15)14(3)21(16)29-22)30-19-8-6-5-7-18(19)24(26)27;1-4(2,3)5/h5-8H,4,9-12H2,1-3H3;5H,1-3H3 |
| InChIKey | NRUAIGNRIOYSGM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|