C26H33IN2O7S — CID 126716507
ethyl (2S)-2-[7-iodo-6,9-dimethyl-3-(2-nitrophenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepin-8-yl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 126716507) has the molecular formula C26H33IN2O7S and a molecular weight of 644.53 g/mol. Its IUPAC name is ethyl (2S)-2-[7-iodo-6,9-dimethyl-3-(2-nitrophenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepin-8-yl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | ethyl (2S)-2-[7-iodo-6,9-dimethyl-3-(2-nitrophenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepin-8-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 126716507 |
| Molecular Formula | C26H33IN2O7S |
| Molecular Weight | 644.53 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | ethyl (2S)-2-[7-iodo-6,9-dimethyl-3-(2-nitrophenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepin-8-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCOC(=O)[C@@H](OC(C)(C)C)c1c(C)c2c(c(C)c1I)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C26H33IN2O7S/c1-7-35-25(30)24(36-26(4,5)6)22-16(2)18-12-14-28(15-13-19(18)17(3)23(22)27)37(33,34)21-11-9-8-10-20(21)29(31)32/h8-11,24H,7,12-15H2,1-6H3/t24-/m0/s1 |
| InChIKey | NRNHFLZBBALKTC-DEOSSOPVSA-N |
| XLogP | 5.03 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|