C23H23N — CID 145322301
4,13,13-trimethyl-5-[(Z)-prop-1-enyl]-3-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene (PubChem CID 145322301) has the molecular formula C23H23N and a molecular weight of 313.44 g/mol. Its IUPAC name is 4,13,13-trimethyl-5-[(Z)-prop-1-enyl]-3-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene.
| Compound Name | 4,13,13-trimethyl-5-[(Z)-prop-1-enyl]-3-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 145322301 |
| Molecular Formula | C23H23N |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4,13,13-trimethyl-5-[(Z)-prop-1-enyl]-3-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene |
| SMILES | C/C=C\c1c(C)[nH]c2c1-c1ccccc1C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C23H23N/c1-5-10-16-15(2)24-22-18-12-7-9-14-20(18)23(3,4)19-13-8-6-11-17(19)21(16)22/h5-14,24H,1-4H3/b10-5- |
| InChIKey | PYRLRWYVZYYRCQ-YHYXMXQVSA-N |
| XLogP | 6.33 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |