C18H27N3 — CID 145322438
ethane;6,12,15-triazatetracyclo[9.4.0.01,3.05,10]pentadeca-4,6,8,10,12,14-hexaene (PubChem CID 145322438) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is ethane;6,12,15-triazatetracyclo[9.4.0.01,3.05,10]pentadeca-4,6,8,10,12,14-hexaene.
| Compound Name | ethane;6,12,15-triazatetracyclo[9.4.0.01,3.05,10]pentadeca-4,6,8,10,12,14-hexaene |
|---|---|
| PubChem CID | 145322438 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | ethane;6,12,15-triazatetracyclo[9.4.0.01,3.05,10]pentadeca-4,6,8,10,12,14-hexaene |
| SMILES | C1=NC2=c3cccnc3=CC3CC23N=C1.CC.CC.CC |
| InChI | InChI=1S/C12H9N3.3C2H6/c1-2-9-10(13-3-1)6-8-7-12(8)11(9)14-4-5-15-12;3*1-2/h1-6,8H,7H2;3*1-2H3 |
| InChIKey | DJKCBRCRWIRRCS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |