C12H9N3 — CID 145322439
6,12,15-triazatetracyclo[9.4.0.01,3.05,10]pentadeca-4,6,8,10,12,14-hexaene (PubChem CID 145322439) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 6,12,15-triazatetracyclo[9.4.0.01,3.05,10]pentadeca-4,6,8,10,12,14-hexaene.
| Compound Name | 6,12,15-triazatetracyclo[9.4.0.01,3.05,10]pentadeca-4,6,8,10,12,14-hexaene |
|---|---|
| PubChem CID | 145322439 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6,12,15-triazatetracyclo[9.4.0.01,3.05,10]pentadeca-4,6,8,10,12,14-hexaene |
| SMILES | C1=NC2=c3cccnc3=CC3CC23N=C1 |
| InChI | InChI=1S/C12H9N3/c1-2-9-10(13-3-1)6-8-7-12(8)11(9)14-4-5-15-12/h1-6,8H,7H2 |
| InChIKey | RFHGJEQLPRYNRB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |