C9H11F4N — CID 145322977
1-[1-fluoro-2-(trifluoromethyl)prop-2-enyl]-3,6-dihydro-2H-pyridine (PubChem CID 145322977) has the molecular formula C9H11F4N and a molecular weight of 209.19 g/mol. Its IUPAC name is 1-[1-fluoro-2-(trifluoromethyl)prop-2-enyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[1-fluoro-2-(trifluoromethyl)prop-2-enyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 145322977 |
| Molecular Formula | C9H11F4N |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 1-[1-fluoro-2-(trifluoromethyl)prop-2-enyl]-3,6-dihydro-2H-pyridine |
| SMILES | C=C(C(F)N1CC=CCC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F4N/c1-7(9(11,12)13)8(10)14-5-3-2-4-6-14/h2-3,8H,1,4-6H2 |
| InChIKey | YZXMCERPSXYGCR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|