C9H10F5N — CID 145322978
1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-3,6-dihydro-2H-pyridine (PubChem CID 145322978) has the molecular formula C9H10F5N and a molecular weight of 227.18 g/mol. Its IUPAC name is 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 145322978 |
| Molecular Formula | C9H10F5N |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-3,6-dihydro-2H-pyridine |
| SMILES | C=C(C(F)(F)F)C(F)(F)N1CC=CCC1 |
| InChI | InChI=1S/C9H10F5N/c1-7(8(10,11)12)9(13,14)15-5-3-2-4-6-15/h2-3H,1,4-6H2 |
| InChIKey | HGTXHDWKGYPABQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|