C31H33ClF3N3O2 — CID 145323450
3-[5-[[4-(2-chlorophenoxy)piperidin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]-N-methylpropan-1-amine (PubChem CID 145323450) has the molecular formula C31H33ClF3N3O2 and a molecular weight of 572.07 g/mol. Its IUPAC name is 3-[5-[[4-(2-chlorophenoxy)piperidin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[5-[[4-(2-chlorophenoxy)piperidin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 145323450 |
| Molecular Formula | C31H33ClF3N3O2 |
| Molecular Weight | 572.07 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 3-[5-[[4-(2-chlorophenoxy)piperidin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCn1cc(-c2ccc(OC(F)(F)F)cc2)c2cc(CN3CCC(Oc4ccccc4Cl)CC3)ccc21 |
| InChI | InChI=1S/C31H33ClF3N3O2/c1-36-15-4-16-38-21-27(23-8-10-25(11-9-23)40-31(33,34)35)26-19-22(7-12-29(26)38)20-37-17-13-24(14-18-37)39-30-6-3-2-5-28(30)32/h2-3,5-12,19,21,24,36H,4,13-18,20H2,1H3 |
| InChIKey | KUWJRYOKOVCBOL-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.07 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|