C36H48ClN5O4S — CID 145323575
tert-butyl N-[3-[3-[2-(aminomethyl)-4-methoxyphenyl]-5-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]indol-1-yl]propyl]carbamate;sulfanol (PubChem CID 145323575) has the molecular formula C36H48ClN5O4S and a molecular weight of 682.33 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[2-(aminomethyl)-4-methoxyphenyl]-5-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]indol-1-yl]propyl]carbamate;sulfanol.
| Compound Name | tert-butyl N-[3-[3-[2-(aminomethyl)-4-methoxyphenyl]-5-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]indol-1-yl]propyl]carbamate;sulfanol |
|---|---|
| PubChem CID | 145323575 |
| Molecular Formula | C36H48ClN5O4S |
| Molecular Weight | 682.33 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | tert-butyl N-[3-[3-[2-(aminomethyl)-4-methoxyphenyl]-5-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]indol-1-yl]propyl]carbamate;sulfanol |
| SMILES | COc1ccc(-c2cn(CCCNC(=O)OC(C)(C)C)c3ccc(CN4CCN(Cc5ccccc5Cl)CC4)cc23)c(CN)c1.OS |
| InChI | InChI=1S/C36H46ClN5O3.H2OS/c1-36(2,3)45-35(43)39-14-7-15-42-25-32(30-12-11-29(44-4)21-28(30)22-38)31-20-26(10-13-34(31)42)23-40-16-18-41(19-17-40)24-27-8-5-6-9-33(27)37;1-2/h5-6,8-13,20-21,25H,7,14-19,22-24,38H2,1-4H3,(H,39,43);1-2H |
| InChIKey | OXOQJBPPYJVFOY-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.33 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|