C34H41ClF3N5O3 — CID 145323630
tert-butyl N-[3-[4-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]-2-[4-(trifluoromethoxy)benzenecarboximidoyl]anilino]propyl]carbamate (PubChem CID 145323630) has the molecular formula C34H41ClF3N5O3 and a molecular weight of 660.18 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]-2-[4-(trifluoromethoxy)benzenecarboximidoyl]anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]-2-[4-(trifluoromethoxy)benzenecarboximidoyl]anilino]propyl]carbamate |
|---|---|
| PubChem CID | 145323630 |
| Molecular Formula | C34H41ClF3N5O3 |
| Molecular Weight | 660.18 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | tert-butyl N-[3-[4-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]-2-[4-(trifluoromethoxy)benzenecarboximidoyl]anilino]propyl]carbamate |
| SMILES | [H]/N=C(\c1ccc(OC(F)(F)F)cc1)c1cc(CN2CCN(Cc3ccccc3Cl)CC2)ccc1NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H41ClF3N5O3/c1-33(2,3)46-32(44)41-16-6-15-40-30-14-9-24(21-28(30)31(39)25-10-12-27(13-11-25)45-34(36,37)38)22-42-17-19-43(20-18-42)23-26-7-4-5-8-29(26)35/h4-5,7-14,21,39-40H,6,15-20,22-23H2,1-3H3,(H,41,44)/b39-31+ |
| InChIKey | WGXZMIZEUCOYAY-KGHBKMJJSA-N |
| XLogP | 7.30 |
| TPSA | 89.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.18 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|