C23H28F3N3O4 — CID 145323607
tert-butyl N-[3-[4-(hydroxymethyl)-2-[4-(trifluoromethoxy)benzenecarboximidoyl]anilino]propyl]carbamate (PubChem CID 145323607) has the molecular formula C23H28F3N3O4 and a molecular weight of 467.49 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(hydroxymethyl)-2-[4-(trifluoromethoxy)benzenecarboximidoyl]anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(hydroxymethyl)-2-[4-(trifluoromethoxy)benzenecarboximidoyl]anilino]propyl]carbamate |
|---|---|
| PubChem CID | 145323607 |
| Molecular Formula | C23H28F3N3O4 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | tert-butyl N-[3-[4-(hydroxymethyl)-2-[4-(trifluoromethoxy)benzenecarboximidoyl]anilino]propyl]carbamate |
| SMILES | [H]/N=C(\c1ccc(OC(F)(F)F)cc1)c1cc(CO)ccc1NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H28F3N3O4/c1-22(2,3)33-21(31)29-12-4-11-28-19-10-5-15(14-30)13-18(19)20(27)16-6-8-17(9-7-16)32-23(24,25)26/h5-10,13,27-28,30H,4,11-12,14H2,1-3H3,(H,29,31)/b27-20+ |
| InChIKey | LLNVDQKOWLIPGT-NHFJDJAPSA-N |
| XLogP | 4.82 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|