C34H48ClN5O — CID 145323610
3-[5-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]-3-[(Z,1Z)-1-(1-methoxyethenylimino)hex-2-en-2-yl]indol-1-yl]propan-1-amine;ethane (PubChem CID 145323610) has the molecular formula C34H48ClN5O and a molecular weight of 578.25 g/mol. Its IUPAC name is 3-[5-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]-3-[(Z,1Z)-1-(1-methoxyethenylimino)hex-2-en-2-yl]indol-1-yl]propan-1-amine;ethane.
| Compound Name | 3-[5-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]-3-[(Z,1Z)-1-(1-methoxyethenylimino)hex-2-en-2-yl]indol-1-yl]propan-1-amine;ethane |
|---|---|
| PubChem CID | 145323610 |
| Molecular Formula | C34H48ClN5O |
| Molecular Weight | 578.25 g/mol |
| Exact Mass | 577.35 |
| IUPAC Name | 3-[5-[[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methyl]-3-[(Z,1Z)-1-(1-methoxyethenylimino)hex-2-en-2-yl]indol-1-yl]propan-1-amine;ethane |
| SMILES | C=C(/N=C\C(=C/CCC)c1cn(CCCN)c2ccc(CN3CCN(Cc4ccccc4Cl)CC3)cc12)OC.CC |
| InChI | InChI=1S/C32H42ClN5O.C2H6/c1-4-5-9-27(21-35-25(2)39-3)30-24-38(15-8-14-34)32-13-12-26(20-29(30)32)22-36-16-18-37(19-17-36)23-28-10-6-7-11-31(28)33;1-2/h6-7,9-13,20-21,24H,2,4-5,8,14-19,22-23,34H2,1,3H3;1-2H3/b27-9+,35-21-; |
| InChIKey | KBJJANHUODRXJG-UBTRKSMASA-N |
| XLogP | 7.36 |
| TPSA | 59.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.25 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|