C19H21N5 — CID 145324073
piperidin-1-yl-[4-(pyrazolo[4,5-c]pyridin-1-ylmethyl)phenyl]methanimine (PubChem CID 145324073) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is piperidin-1-yl-[4-(pyrazolo[4,5-c]pyridin-1-ylmethyl)phenyl]methanimine.
| Compound Name | piperidin-1-yl-[4-(pyrazolo[4,5-c]pyridin-1-ylmethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 145324073 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | piperidin-1-yl-[4-(pyrazolo[4,5-c]pyridin-1-ylmethyl)phenyl]methanimine |
| SMILES | [H]/N=C(/c1ccc(Cn2ncc3cnccc32)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H21N5/c20-19(23-10-2-1-3-11-23)16-6-4-15(5-7-16)14-24-18-8-9-21-12-17(18)13-22-24/h4-9,12-13,20H,1-3,10-11,14H2/b20-19- |
| InChIKey | JWTIXRAHFAAKLW-VXPUYCOJSA-N |
| XLogP | 3.29 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|