C10H22N2 — CID 145324664
ethane;[(1Z,4Z)-hexa-1,4-dienyl]diazene (PubChem CID 145324664) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;[(1Z,4Z)-hexa-1,4-dienyl]diazene.
| Compound Name | ethane;[(1Z,4Z)-hexa-1,4-dienyl]diazene |
|---|---|
| PubChem CID | 145324664 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;[(1Z,4Z)-hexa-1,4-dienyl]diazene |
| SMILES | CC.CC.[H]/N=N/C=C\C/C=C\C |
| InChI | InChI=1S/C6H10N2.2C2H6/c1-2-3-4-5-6-8-7;2*1-2/h2-3,5-7H,4H2,1H3;2*1-2H3/b3-2-,6-5-,8-7+;; |
| InChIKey | KYARVCWQVFKVTP-VAQJIHFZSA-N |
| XLogP | 4.55 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|