C8H14N2 — CID 144544290
[(1Z,4Z)-3,3-dimethylhexa-1,4-dienyl]diazene (PubChem CID 144544290) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is [(1Z,4Z)-3,3-dimethylhexa-1,4-dienyl]diazene.
| Compound Name | [(1Z,4Z)-3,3-dimethylhexa-1,4-dienyl]diazene |
|---|---|
| PubChem CID | 144544290 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | [(1Z,4Z)-3,3-dimethylhexa-1,4-dienyl]diazene |
| SMILES | [H]/N=N/C=C\C(C)(C)/C=C\C |
| InChI | InChI=1S/C8H14N2/c1-4-5-8(2,3)6-7-10-9/h4-7,9H,1-3H3/b5-4-,7-6-,10-9+ |
| InChIKey | UMDIDQVUVRWSMF-KVEPPTFVSA-N |
| XLogP | 3.13 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|