C8H12BrN — CID 145324666
N-[(1E,3E)-2-bromohexa-1,3-dienyl]ethanimine (PubChem CID 145324666) has the molecular formula C8H12BrN and a molecular weight of 202.09 g/mol. Its IUPAC name is N-[(1E,3E)-2-bromohexa-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E,3E)-2-bromohexa-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 145324666 |
| Molecular Formula | C8H12BrN |
| Molecular Weight | 202.09 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | N-[(1E,3E)-2-bromohexa-1,3-dienyl]ethanimine |
| SMILES | C/C=N/C=C(Br)\C=C\CC |
| InChI | InChI=1S/C8H12BrN/c1-3-5-6-8(9)7-10-4-2/h4-7H,3H2,1-2H3/b6-5+,8-7+,10-4+ |
| InChIKey | RROZKASHRUVKRE-RUCBVRGHSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.09 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|