C48H35BrN2 — CID 145327293
N'-[(Z)-1-[4-[5-(6-bromonaphthalen-1-yl)naphthalen-2-yl]phenyl]-3-(4-phenylphenyl)prop-1-enyl]benzenecarboximidamide (PubChem CID 145327293) has the molecular formula C48H35BrN2 and a molecular weight of 719.73 g/mol. Its IUPAC name is N'-[(Z)-1-[4-[5-(6-bromonaphthalen-1-yl)naphthalen-2-yl]phenyl]-3-(4-phenylphenyl)prop-1-enyl]benzenecarboximidamide.
| Compound Name | N'-[(Z)-1-[4-[5-(6-bromonaphthalen-1-yl)naphthalen-2-yl]phenyl]-3-(4-phenylphenyl)prop-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145327293 |
| Molecular Formula | C48H35BrN2 |
| Molecular Weight | 719.73 g/mol |
| Exact Mass | 718.20 |
| IUPAC Name | N'-[(Z)-1-[4-[5-(6-bromonaphthalen-1-yl)naphthalen-2-yl]phenyl]-3-(4-phenylphenyl)prop-1-enyl]benzenecarboximidamide |
| SMILES | N/C(=N\C(=C/Cc1ccc(-c2ccccc2)cc1)c1ccc(-c2ccc3c(-c4cccc5cc(Br)ccc45)cccc3c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C48H35BrN2/c49-42-27-29-44-41(32-42)14-8-16-46(44)45-15-7-13-40-31-39(26-28-43(40)45)36-22-24-37(25-23-36)47(51-48(50)38-11-5-2-6-12-38)30-19-33-17-20-35(21-18-33)34-9-3-1-4-10-34/h1-18,20-32H,19H2,(H2,50,51)/b47-30- |
| InChIKey | OJZGGWRZESFQPN-AQYQVBIESA-N |
| XLogP | 12.75 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.73 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|