C23H33FN6 — CID 145330517
(Z)-4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-fluorophenyl]-4-imino-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)but-2-enimidamide (PubChem CID 145330517) has the molecular formula C23H33FN6 and a molecular weight of 412.56 g/mol. Its IUPAC name is (Z)-4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-fluorophenyl]-4-imino-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)but-2-enimidamide.
| Compound Name | (Z)-4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-fluorophenyl]-4-imino-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)but-2-enimidamide |
|---|---|
| PubChem CID | 145330517 |
| Molecular Formula | C23H33FN6 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (Z)-4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-fluorophenyl]-4-imino-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)but-2-enimidamide |
| SMILES | [H]/N=C(/C=C\C(=N\[H])N(C)C1CC(C)(C)NC(C)(C)C1)c1ccc(C(=C/N)/C=N/[H])cc1F |
| InChI | InChI=1S/C23H33FN6/c1-22(2)11-17(12-23(3,4)29-22)30(5)21(28)9-8-20(27)18-7-6-15(10-19(18)24)16(13-25)14-26/h6-10,13-14,17,25,27-29H,11-12,26H2,1-5H3/b9-8-,16-14+,25-13+,27-20-,28-21- |
| InChIKey | TUWUJIZVPMXUCU-VKWXPASNSA-N |
| XLogP | 3.92 |
| TPSA | 112.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|