C16H28N4 — CID 145331038
butane;(1E)-N,N-dimethyl-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)buta-1,3-dien-1-amine (PubChem CID 145331038) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is butane;(1E)-N,N-dimethyl-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)buta-1,3-dien-1-amine.
| Compound Name | butane;(1E)-N,N-dimethyl-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145331038 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | butane;(1E)-N,N-dimethyl-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)buta-1,3-dien-1-amine |
| SMILES | C=C/C(=C\N(C)C)c1cnc2n1CCNC2.CCCC |
| InChI | InChI=1S/C12H18N4.C4H10/c1-4-10(9-15(2)3)11-7-14-12-8-13-5-6-16(11)12;1-3-4-2/h4,7,9,13H,1,5-6,8H2,2-3H3;3-4H2,1-2H3/b10-9+; |
| InChIKey | BHEVEMKJTUMGBN-RRABGKBLSA-N |
| XLogP | 2.88 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|