C9H11F3N4O — CID 97406262
N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-3-carboxamide (PubChem CID 97406262) has the molecular formula C9H11F3N4O and a molecular weight of 248.21 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 97406262 |
| Molecular Formula | C9H11F3N4O |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cnc2n1CCNC2 |
| InChI | InChI=1S/C9H11F3N4O/c10-9(11,12)5-15-8(17)6-3-14-7-4-13-1-2-16(6)7/h3,13H,1-2,4-5H2,(H,15,17) |
| InChIKey | HYXPTYJDLXJWPF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |