C19H20ClN4O2P — CID 145331229
[(3S)-7-chloro-3-methyl-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-yl]oxy-morpholin-4-ylphosphane (PubChem CID 145331229) has the molecular formula C19H20ClN4O2P and a molecular weight of 402.82 g/mol. Its IUPAC name is [(3S)-7-chloro-3-methyl-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-yl]oxy-morpholin-4-ylphosphane.
| Compound Name | [(3S)-7-chloro-3-methyl-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-yl]oxy-morpholin-4-ylphosphane |
|---|---|
| PubChem CID | 145331229 |
| Molecular Formula | C19H20ClN4O2P |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [(3S)-7-chloro-3-methyl-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-yl]oxy-morpholin-4-ylphosphane |
| SMILES | C[C@@H]1N=C(c2ccccn2)c2cc(Cl)ccc2N=C1OPN1CCOCC1 |
| InChI | InChI=1S/C19H20ClN4O2P/c1-13-19(26-27-24-8-10-25-11-9-24)23-16-6-5-14(20)12-15(16)18(22-13)17-4-2-3-7-21-17/h2-7,12-13,27H,8-11H2,1H3/t13-/m0/s1 |
| InChIKey | GCVPJMIDKSOEQW-ZDUSSCGKSA-N |
| XLogP | 3.86 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|