C36H30 — CID 145331695
(3Z,6Z)-13-methyl-2,8-dimethylidene-13-phenylspiro[bicyclo[8.5.0]pentadeca-1(10),3,6,11,14-pentaene-9,9'-fluorene] (PubChem CID 145331695) has the molecular formula C36H30 and a molecular weight of 462.64 g/mol. Its IUPAC name is (3Z,6Z)-13-methyl-2,8-dimethylidene-13-phenylspiro[bicyclo[8.5.0]pentadeca-1(10),3,6,11,14-pentaene-9,9'-fluorene].
| Compound Name | (3Z,6Z)-13-methyl-2,8-dimethylidene-13-phenylspiro[bicyclo[8.5.0]pentadeca-1(10),3,6,11,14-pentaene-9,9'-fluorene] |
|---|---|
| PubChem CID | 145331695 |
| Molecular Formula | C36H30 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (3Z,6Z)-13-methyl-2,8-dimethylidene-13-phenylspiro[bicyclo[8.5.0]pentadeca-1(10),3,6,11,14-pentaene-9,9'-fluorene] |
| SMILES | C=C1/C=C\C/C=C\C(=C)C2(C3=C1C=CC(C)(c1ccccc1)C=C3)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C36H30/c1-26-14-6-4-7-15-27(2)36(32-20-12-10-18-30(32)31-19-11-13-21-33(31)36)34-23-25-35(3,24-22-29(26)34)28-16-8-5-9-17-28/h5-25H,1-2,4H2,3H3/b14-6-,15-7- |
| InChIKey | FTJWNOHNDGSEPW-LRSUZXNRSA-N |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |