C26H23N3 — CID 167268597
2-phenyl-4-(7,10,10-trimethylbenzo[a]azulen-7-yl)-1,3,5-triazine (PubChem CID 167268597) has the molecular formula C26H23N3 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-phenyl-4-(7,10,10-trimethylbenzo[a]azulen-7-yl)-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(7,10,10-trimethylbenzo[a]azulen-7-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 167268597 |
| Molecular Formula | C26H23N3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-phenyl-4-(7,10,10-trimethylbenzo[a]azulen-7-yl)-1,3,5-triazine |
| SMILES | CC1(c2ncnc(-c3ccccc3)n2)C=CC2=C(C=C1)C(C)(C)c1ccccc12 |
| InChI | InChI=1S/C26H23N3/c1-25(2)21-12-8-7-11-19(21)20-13-15-26(3,16-14-22(20)25)24-28-17-27-23(29-24)18-9-5-4-6-10-18/h4-17H,1-3H3 |
| InChIKey | GYSJVJOYJCVEAZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |