C22H30N6O — CID 145336440
8-[5-[[4-(dimethylamino)-1-oxobutan-2-yl]amino]-3,3-dimethylpiperidin-1-yl]quinoxaline-5-carbonitrile (PubChem CID 145336440) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 8-[5-[[4-(dimethylamino)-1-oxobutan-2-yl]amino]-3,3-dimethylpiperidin-1-yl]quinoxaline-5-carbonitrile.
| Compound Name | 8-[5-[[4-(dimethylamino)-1-oxobutan-2-yl]amino]-3,3-dimethylpiperidin-1-yl]quinoxaline-5-carbonitrile |
|---|---|
| PubChem CID | 145336440 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 8-[5-[[4-(dimethylamino)-1-oxobutan-2-yl]amino]-3,3-dimethylpiperidin-1-yl]quinoxaline-5-carbonitrile |
| SMILES | CN(C)CCC(C=O)NC1CN(c2ccc(C#N)c3nccnc23)CC(C)(C)C1 |
| InChI | InChI=1S/C22H30N6O/c1-22(2)11-18(26-17(14-29)7-10-27(3)4)13-28(15-22)19-6-5-16(12-23)20-21(19)25-9-8-24-20/h5-6,8-9,14,17-18,26H,7,10-11,13,15H2,1-4H3 |
| InChIKey | DRQNGCZIPYPCJL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|