C18H20F3N5O — CID 129240583
8-[(3S,5R)-3-(2-methoxyethylamino)-5-(trifluoromethyl)piperidin-1-yl]quinoxaline-5-carbonitrile (PubChem CID 129240583) has the molecular formula C18H20F3N5O and a molecular weight of 379.39 g/mol. Its IUPAC name is 8-[(3S,5R)-3-(2-methoxyethylamino)-5-(trifluoromethyl)piperidin-1-yl]quinoxaline-5-carbonitrile.
| Compound Name | 8-[(3S,5R)-3-(2-methoxyethylamino)-5-(trifluoromethyl)piperidin-1-yl]quinoxaline-5-carbonitrile |
|---|---|
| PubChem CID | 129240583 |
| Molecular Formula | C18H20F3N5O |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 8-[(3S,5R)-3-(2-methoxyethylamino)-5-(trifluoromethyl)piperidin-1-yl]quinoxaline-5-carbonitrile |
| SMILES | COCCN[C@H]1C[C@@H](C(F)(F)F)CN(c2ccc(C#N)c3nccnc23)C1 |
| InChI | InChI=1S/C18H20F3N5O/c1-27-7-6-23-14-8-13(18(19,20)21)10-26(11-14)15-3-2-12(9-22)16-17(15)25-5-4-24-16/h2-5,13-14,23H,6-8,10-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | GXIJHTNAYDCDCK-KGLIPLIRSA-N |
| XLogP | 2.49 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|