C23H26F3N7O — CID 156694852
N-[(3R,5S)-1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-2-(4-methylpiperazin-1-yl)prop-2-enamide (PubChem CID 156694852) has the molecular formula C23H26F3N7O and a molecular weight of 473.50 g/mol. Its IUPAC name is N-[(3R,5S)-1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-2-(4-methylpiperazin-1-yl)prop-2-enamide.
| Compound Name | N-[(3R,5S)-1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-2-(4-methylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 156694852 |
| Molecular Formula | C23H26F3N7O |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[(3R,5S)-1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-2-(4-methylpiperazin-1-yl)prop-2-enamide |
| SMILES | C=C(C(=O)N[C@@H]1C[C@H](C(F)(F)F)CN(c2ccc(C#N)c3nccnc23)C1)N1CCN(C)CC1 |
| InChI | InChI=1S/C23H26F3N7O/c1-15(32-9-7-31(2)8-10-32)22(34)30-18-11-17(23(24,25)26)13-33(14-18)19-4-3-16(12-27)20-21(19)29-6-5-28-20/h3-6,17-18H,1,7-11,13-14H2,2H3,(H,30,34)/t17-,18+/m0/s1 |
| InChIKey | ZRLSXMYZGKIVRE-ZWKOTPCHSA-N |
| XLogP | 2.14 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|