About N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide
N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide (PubChem CID 129241040) has the molecular formula C21H24F3N5O
and a molecular weight of 419.45 g/mol. Its IUPAC name is N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide |
| PubChem CID | 129241040 |
| Molecular Formula | C21H24F3N5O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC1CC(C(F)(F)F)CN(c2ccc(C#N)c3nccnc23)C1 |
| InChI | InChI=1S/C21H24F3N5O/c1-20(2,3)9-17(30)28-15-8-14(21(22,23)24)11-29(12-15)16-5-4-13(10-25)18-19(16)27-7-6-26-18/h4-7,14-15H,8-9,11-12H2,1-3H3,(H,28,30) |
| InChIKey | KKWCTWDIXYLTRU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide?
The IUPAC name of N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide (CID 129241040) is N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide.
What is the SMILES notation for N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide?
The canonical SMILES for N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide is CC(C)(C)CC(=O)NC1CC(C(F)(F)F)CN(c2ccc(C#N)c3nccnc23)C1.
What is the InChIKey of N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide?
The InChIKey is KKWCTWDIXYLTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F3N5O/c1-20(2,3)9-17(30)28-15-8-14(21(22,23)24)11-29(12-15)16-5-4-13(10-25)18-19(16)27-7-6-26-18/h4-7,14-15H,8-9,11-12H2,1-3H3,(H,28,30).
What are the key properties of N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide?
N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide has a molecular weight of 419.45 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(8-cyanoquinoxalin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]-3,3-dimethylbutanamide is sourced from PubChem (CID 129241040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).