C12H14IN7S — CID 145336822
[4-amino-2-[(1-propan-2-ylpyrazol-4-yl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite (PubChem CID 145336822) has the molecular formula C12H14IN7S and a molecular weight of 415.26 g/mol. Its IUPAC name is [4-amino-2-[(1-propan-2-ylpyrazol-4-yl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite.
| Compound Name | [4-amino-2-[(1-propan-2-ylpyrazol-4-yl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
|---|---|
| PubChem CID | 145336822 |
| Molecular Formula | C12H14IN7S |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | [4-amino-2-[(1-propan-2-ylpyrazol-4-yl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
| SMILES | CC(C)n1cc(Nc2nc(N)c3ccn(SI)c3n2)cn1 |
| InChI | InChI=1S/C12H14IN7S/c1-7(2)19-6-8(5-15-19)16-12-17-10(14)9-3-4-20(21-13)11(9)18-12/h3-7H,1-2H3,(H3,14,16,17,18) |
| InChIKey | BHOSMRZTJDQHCK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|