C18H16ClNO4S — CID 145337116
methyl 5-[(4-chlorophenyl)sulfanylamino]-2-(methoxymethyl)-1-benzofuran-3-carboxylate (PubChem CID 145337116) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is methyl 5-[(4-chlorophenyl)sulfanylamino]-2-(methoxymethyl)-1-benzofuran-3-carboxylate.
| Compound Name | methyl 5-[(4-chlorophenyl)sulfanylamino]-2-(methoxymethyl)-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 145337116 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | methyl 5-[(4-chlorophenyl)sulfanylamino]-2-(methoxymethyl)-1-benzofuran-3-carboxylate |
| SMILES | COCc1oc2ccc(NSc3ccc(Cl)cc3)cc2c1C(=O)OC |
| InChI | InChI=1S/C18H16ClNO4S/c1-22-10-16-17(18(21)23-2)14-9-12(5-8-15(14)24-16)20-25-13-6-3-11(19)4-7-13/h3-9,20H,10H2,1-2H3 |
| InChIKey | UDQVMZZLVJOIPW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|