C23H21F5N10O2 — CID 145337148
4-amino-5-[1-(3-hydroxybut-3-enyl)triazol-4-yl]-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 145337148) has the molecular formula C23H21F5N10O2 and a molecular weight of 564.48 g/mol. Its IUPAC name is 4-amino-5-[1-(3-hydroxybut-3-enyl)triazol-4-yl]-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-[1-(3-hydroxybut-3-enyl)triazol-4-yl]-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 145337148 |
| Molecular Formula | C23H21F5N10O2 |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 4-amino-5-[1-(3-hydroxybut-3-enyl)triazol-4-yl]-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | C=C(O)CCn1cc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5ncccc45)nc(N)c32)nn1 |
| InChI | InChI=1S/C23H21F5N10O2/c1-11(39)5-8-37-10-13(34-36-37)21(2)14-16(29)31-18(32-17(14)33-20(21)40)15-12-4-3-7-30-19(12)38(35-15)9-6-22(24,25)23(26,27)28/h3-4,7,10,39H,1,5-6,8-9H2,2H3,(H3,29,31,32,33,40) |
| InChIKey | QPPHJTNCQRWHEF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 162.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|