C17H14F5N7O — CID 139537889
(5R)-4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 139537889) has the molecular formula C17H14F5N7O and a molecular weight of 427.34 g/mol. Its IUPAC name is (5R)-4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | (5R)-4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 139537889 |
| Molecular Formula | C17H14F5N7O |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (5R)-4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | C[C@H]1C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4ncccc34)nc(N)c21 |
| InChI | InChI=1S/C17H14F5N7O/c1-7-9-11(23)25-13(26-12(9)27-15(7)30)10-8-3-2-5-24-14(8)29(28-10)6-4-16(18,19)17(20,21)22/h2-3,5,7H,4,6H2,1H3,(H3,23,25,26,27,30)/t7-/m1/s1 |
| InChIKey | PKJIEIBMWMSPCQ-SSDOTTSWSA-N |
| XLogP | 3.11 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|