C20H15F6N7O3 — CID 172547901
(4S,5R)-10-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-4-methoxy-5-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3,6-dione (PubChem CID 172547901) has the molecular formula C20H15F6N7O3 and a molecular weight of 515.37 g/mol. Its IUPAC name is (4S,5R)-10-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-4-methoxy-5-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3,6-dione.
| Compound Name | (4S,5R)-10-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-4-methoxy-5-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3,6-dione |
|---|---|
| PubChem CID | 172547901 |
| Molecular Formula | C20H15F6N7O3 |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | (4S,5R)-10-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-4-methoxy-5-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3,6-dione |
| SMILES | CO[C@]12C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5ncc(F)cc45)nc(c31)NC(=O)[C@@H]2C |
| InChI | InChI=1S/C20H15F6N7O3/c1-7-16(34)30-12-10-13(31-17(35)19(7,10)36-2)29-14(28-12)11-9-5-8(21)6-27-15(9)33(32-11)4-3-18(22,23)20(24,25)26/h5-7H,3-4H2,1-2H3,(H2,28,29,30,31,34,35)/t7-,19-/m0/s1 |
| InChIKey | YJQKPYZVOAHKNR-IIYDVTGLSA-N |
| XLogP | 3.00 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|