C17H10F5N6O3- — CID 154065901
6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 154065901) has the molecular formula C17H10F5N6O3- and a molecular weight of 441.30 g/mol. Its IUPAC name is 6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | 6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 154065901 |
| Molecular Formula | C17H10F5N6O3- |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | O=C([O-])C1C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4ncccc34)ncc21 |
| InChI | InChI=1S/C17H11F5N6O3/c18-16(19,17(20,21)22)3-5-28-13-7(2-1-4-23-13)10(27-28)12-24-6-8-9(15(30)31)14(29)26-11(8)25-12/h1-2,4,6,9H,3,5H2,(H,30,31)(H,24,25,26,29)/p-1 |
| InChIKey | CAPLUQUBRNFOJF-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|