C11H20N2O — CID 145337729
ethane;6-ethyl-4,5,6,7-tetrahydro-1H-indazol-7-ol (PubChem CID 145337729) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is ethane;6-ethyl-4,5,6,7-tetrahydro-1H-indazol-7-ol.
| Compound Name | ethane;6-ethyl-4,5,6,7-tetrahydro-1H-indazol-7-ol |
|---|---|
| PubChem CID | 145337729 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | ethane;6-ethyl-4,5,6,7-tetrahydro-1H-indazol-7-ol |
| SMILES | CC.CCC1CCc2cn[nH]c2C1O |
| InChI | InChI=1S/C9H14N2O.C2H6/c1-2-6-3-4-7-5-10-11-8(7)9(6)12;1-2/h5-6,9,12H,2-4H2,1H3,(H,10,11);1-2H3 |
| InChIKey | GHCCISTWDHYNIF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |