C12H22N2O — CID 145337884
ethane;5-ethyl-2-methyl-4,5,6,7-tetrahydroindazol-4-ol (PubChem CID 145337884) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is ethane;5-ethyl-2-methyl-4,5,6,7-tetrahydroindazol-4-ol.
| Compound Name | ethane;5-ethyl-2-methyl-4,5,6,7-tetrahydroindazol-4-ol |
|---|---|
| PubChem CID | 145337884 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | ethane;5-ethyl-2-methyl-4,5,6,7-tetrahydroindazol-4-ol |
| SMILES | CC.CCC1CCc2nn(C)cc2C1O |
| InChI | InChI=1S/C10H16N2O.C2H6/c1-3-7-4-5-9-8(10(7)13)6-12(2)11-9;1-2/h6-7,10,13H,3-5H2,1-2H3;1-2H3 |
| InChIKey | NYKXKDHOIHRDQT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |