C27H28N2 — CID 145340796
(5Z,7Z,9E)-10-[4-(1a,7a-dihydro-1H-cyclopropa[b]naphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,9-dimethyl-1,4-dihydro-1,3-diazecine (PubChem CID 145340796) has the molecular formula C27H28N2 and a molecular weight of 380.54 g/mol. Its IUPAC name is (5Z,7Z,9E)-10-[4-(1a,7a-dihydro-1H-cyclopropa[b]naphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,9-dimethyl-1,4-dihydro-1,3-diazecine.
| Compound Name | (5Z,7Z,9E)-10-[4-(1a,7a-dihydro-1H-cyclopropa[b]naphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,9-dimethyl-1,4-dihydro-1,3-diazecine |
|---|---|
| PubChem CID | 145340796 |
| Molecular Formula | C27H28N2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (5Z,7Z,9E)-10-[4-(1a,7a-dihydro-1H-cyclopropa[b]naphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,9-dimethyl-1,4-dihydro-1,3-diazecine |
| SMILES | C/C1=N/C/C=C\C=C/C(C)=C(\C2=CC=C(C3=c4ccccc4=CC4CC34)CC2)N1 |
| InChI | InChI=1S/C27H28N2/c1-18-8-4-3-7-15-28-19(2)29-27(18)21-13-11-20(12-14-21)26-24-10-6-5-9-22(24)16-23-17-25(23)26/h3-11,13,16,23,25H,12,14-15,17H2,1-2H3,(H,28,29)/b7-3-,8-4-,27-18+ |
| InChIKey | KZDMJYMXDFQXAP-OFKLQQDTSA-N |
| XLogP | 4.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |